logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Benzimidazoles  > 1H-Benzimidazole-5-boronic acid, pinacol ester

AA03303

1007206-54-3 | 1H-Benzimidazole-5-boronic acid, pinacol ester

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $13.00 $9.00 -   +
250mg 95% in stock $25.00 $17.00 -   +
1g 95% in stock $34.00 $24.00 -   +
5g 95% in stock $165.00 $116.00 -   +
25g 95% in stock $715.00 $500.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA03303
Chemical Name: 1H-Benzimidazole-5-boronic acid, pinacol ester
CAS Number: 1007206-54-3
Molecular Formula: C13H17BN2O2
Molecular Weight: 244.0973
MDL Number: MFCD11054041
SMILES: CC1(C)OB(OC1(C)C)c1ccc2c(c1)[nH]cn2

 

Computed Properties
Complexity: 319  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 18  
Hydrogen Bond Acceptor Count: 3  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 1  

 

 

Upstream Synthesis Route
  • 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazole is a versatile compound widely utilized in chemical synthesis as a key building block for creating advanced materials and functional molecules. In the realm of organic chemistry, this specific derivative plays a crucial role in the formation of complex molecular structures through cross-coupling reactions, particularly in palladium-catalyzed coupling reactions. Its unique boron-containing group enables selective and efficient incorporation into target molecules, allowing for precise control over the chemical reactions and the formation of desired products. Additionally, the benzimidazole moiety in this compound imparts specific electronic and steric properties, further enhancing its utility in the design and synthesis of novel organic compounds for various applications.
FEATURED PRODUCTS