AA03332
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $26.00 | $18.00 | - + | |
1g | 95% | in stock | $32.00 | $22.00 | - + | |
5g | 95% | in stock | $146.00 | $102.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA03332 |
Chemical Name: | 1-Methyl-1H-indazole-6-carboxylic acid methyl ester |
CAS Number: | 1007219-73-9 |
Molecular Formula: | C10H10N2O2 |
Molecular Weight: | 190.1986 |
MDL Number: | MFCD11109403 |
SMILES: | COC(=O)c1ccc2c(c1)n(C)nc2 |
Complexity: | 232 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | 2 |
Methyl 1-methyl-1H-indazole-6-carboxylate is a valuable compound in chemical synthesis due to its versatility and utility in various reactions. This compound serves as a key building block in the synthesis of novel pharmaceuticals, agrochemicals, and materials. Its unique structure and reactivity make it particularly useful in the formation of more complex molecules through various synthetic routes. When combined with other reagents or catalysts, Methyl 1-methyl-1H-indazole-6-carboxylate can participate in a range of transformations such as cycloaddition reactions, cross-coupling reactions, and functional group manipulations. Its presence in the synthesis of drug candidates, natural products, and functional materials highlights its significance in modern organic chemistry research and development efforts.