logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Indazoles  > 1-Methyl-1H-indazole-6-carboxylic acid methyl ester

AA03332

1007219-73-9 | 1-Methyl-1H-indazole-6-carboxylic acid methyl ester

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $26.00 $18.00 -   +
1g 95% in stock $32.00 $22.00 -   +
5g 95% in stock $146.00 $102.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA03332
Chemical Name: 1-Methyl-1H-indazole-6-carboxylic acid methyl ester
CAS Number: 1007219-73-9
Molecular Formula: C10H10N2O2
Molecular Weight: 190.1986
MDL Number: MFCD11109403
SMILES: COC(=O)c1ccc2c(c1)n(C)nc2

 

Computed Properties
Complexity: 232  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 14  
Hydrogen Bond Acceptor Count: 3  
Rotatable Bond Count: 2  
XLogP3: 2  

 

 

Upstream Synthesis Route
  • Methyl 1-methyl-1H-indazole-6-carboxylate is a valuable compound in chemical synthesis due to its versatility and utility in various reactions. This compound serves as a key building block in the synthesis of novel pharmaceuticals, agrochemicals, and materials. Its unique structure and reactivity make it particularly useful in the formation of more complex molecules through various synthetic routes. When combined with other reagents or catalysts, Methyl 1-methyl-1H-indazole-6-carboxylate can participate in a range of transformations such as cycloaddition reactions, cross-coupling reactions, and functional group manipulations. Its presence in the synthesis of drug candidates, natural products, and functional materials highlights its significance in modern organic chemistry research and development efforts.
FEATURED PRODUCTS