AA03509
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 98% | in stock | $33.00 | $23.00 | - + | |
100mg | 98% | in stock | $74.00 | $52.00 | - + | |
1g | 98% | in stock | $105.00 | $74.00 | - + | |
5g | 98% | in stock | $249.00 | $175.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA03509 |
Chemical Name: | 1H-Pyrazole-4-carboxylic acid, 3-chloro-5-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-1-methyl-, methyl ester |
CAS Number: | 100784-20-1 |
Molecular Formula: | C13H15ClN6O7S |
Molecular Weight: | 434.8122 |
MDL Number: | MFCD07369918 |
SMILES: | COc1nc(nc(c1)OC)NC(=O)NS(=O)(=O)c1n(C)nc(c1C(=O)OC)Cl |
Complexity: | 665 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 28 |
Hydrogen Bond Acceptor Count: | 10 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 7 |
XLogP3: | 1.3 |
In chemical synthesis, Methyl 3-chloro-5-(N-((4,6-dimethoxypyrimidin-2-yl)carbamoyl)sulfamoyl)-1-methyl-1H-pyrazole-4-carboxylate serves as a versatile building block for the creation of complex pharmaceuticals and agrochemicals. Its strategic placement of functional groups allows for precise modification, enabling the synthesis of novel compounds with potential biological activities. This compound's unique structure offers opportunities for diversification through various chemical transformations, making it a valuable tool in the development of new molecules with desired properties.
Talanta 20101015
Journal of agricultural and food chemistry 20080827