AA03528
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $28.00 | $19.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA03528 |
Chemical Name: | (2S,2'S)-Di-tert-butyl 2,2'-(5,5'-([1,1'-biphenyl]-4,4'-diyl)bis(1h-imidazole-5,2-diyl))bis(pyrrolidine-1-carboxylate) |
CAS Number: | 1007882-23-6 |
Molecular Formula: | C36H44N6O4 |
Molecular Weight: | 624.7723600000005 |
MDL Number: | MFCD28404669 |
SMILES: | O=C(N1CCC[C@H]1c1ncc([nH]1)c1ccc(cc1)c1ccc(cc1)c1cnc([nH]1)[C@@H]1CCCN1C(=O)OC(C)(C)C)OC(C)(C)C |
1,1'-Bis(1,1-dimethylethyl) (2S,2'S)-2,2'-([1,1'-biphenyl]-4,4'-diyldi-1H-imidazole-5,2-diyl)bis[1-pyrrolidinecarboxylate] is a versatile compound commonly used in chemical synthesis. This compound serves as an effective catalyst in various organic reactions, particularly in asymmetric catalysis. Its unique structure and chiral properties make it a valuable tool for creating enantiomerically pure compounds. By utilizing this compound in chemical synthesis, researchers and chemists can efficiently produce complex molecules with high stereoselectivity. Furthermore, its application in catalysis can lead to the development of novel drugs, agrochemicals, and materials with enhanced properties.