logo
Home  > 7-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine

AA03608

1008112-03-5 | 7-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $117.00 $82.00 -   +
250mg 95% in stock $194.00 $136.00 -   +
500mg 95% in stock $326.00 $228.00 -   +
1g 95% in stock $487.00 $341.00 -   +
5g 95% in stock $1,458.00 $1,021.00 -   +
10g 95% in stock $2,431.00 $1,702.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA03608
Chemical Name: 7-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine
CAS Number: 1008112-03-5
Molecular Formula: C6H2BrCl2N3
Molecular Weight: 266.9102
MDL Number: MFCD22415227
SMILES: Clc1nc(Cl)c2n(n1)c(Br)cc2

 

Upstream Synthesis Route 
  • 7-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine is a versatile chemical compound widely utilized in chemical synthesis as a key building block for the creation of various pharmaceuticals, agrochemicals, and materials. This compound serves as a valuable intermediate in the production of complex organic molecules due to its unique reactivity and structural properties. In the realm of medicinal chemistry, it is commonly employed in the synthesis of novel drug candidates with potential therapeutic applications. Additionally, in the field of materials science, 7-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine is utilized for the design and development of advanced polymers and specialty chemicals. Its strategic placement of bromine and chlorine atoms enables precise control over reaction pathways, making it a crucial component in the synthesis of diverse chemical products.
FEATURED PRODUCTS