AA03680
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $12.00 | $9.00 | - + | |
1g | 98% | in stock | $34.00 | $24.00 | - + | |
5g | 98% | in stock | $104.00 | $73.00 | - + | |
10g | 98% | in stock | $160.00 | $112.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA03680 |
Chemical Name: | 5-(Trifluoromethyl)indole |
CAS Number: | 100846-24-0 |
Molecular Formula: | C9H6F3N |
Molecular Weight: | 185.1458 |
MDL Number: | MFCD03095341 |
SMILES: | FC(c1ccc2c(c1)cc[nH]2)(F)F |
Complexity: | 190 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 3.2 |
5-(Trifluoromethyl)indole is a versatile compound commonly used in chemical synthesis as a building block for the creation of complex organic molecules. Its unique trifluoromethyl group imparts distinct physicochemical properties, making it highly valuable in drug discovery, materials science, and agrochemical research. In organic synthesis, 5-(Trifluoromethyl)indole serves as a key intermediate for the preparation of pharmaceuticals, diverse molecular scaffolds, and functional materials with enhanced biological activities and physical characteristics. Its strategic incorporation in synthetic pathways enables chemists to access molecular structures that are challenging to obtain using traditional methods, offering new opportunities for the development of novel compounds with improved properties and potential applications in various fields of chemistry.