AA03733
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $12.00 | $8.00 | - + | |
1g | 97% | in stock | $18.00 | $13.00 | - + | |
5g | 97% | in stock | $39.00 | $28.00 | - + | |
10g | 97% | in stock | $68.00 | $48.00 | - + | |
25g | 97% | in stock | $139.00 | $98.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA03733 |
Chemical Name: | benzyl (3R)-3-hydroxypiperidine-1-carboxylate |
CAS Number: | 100858-34-2 |
Molecular Formula: | C13H17NO3 |
Molecular Weight: | 235.279 |
MDL Number: | MFCD11112280 |
SMILES: | O[C@@H]1CCCN(C1)C(=O)OCc1ccccc1 |
Complexity: | 251 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.5 |
Application: (R)-Benzyl 3-hydroxypiperidine-1-carboxylate is a versatile compound widely used in chemical synthesis, particularly in the field of organic chemistry. This compound serves as a key building block in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals.Its unique structure and reactivity make it an essential intermediate in the preparation of biologically active molecules. (R)-Benzyl 3-hydroxypiperidine-1-carboxylate can participate in a variety of reactions, such as nucleophilic additions, acylations, and amidations, allowing for the creation of complex molecular structures.Chemists often utilize this compound as a chiral auxiliary due to its ability to influence the stereochemistry of reactions, enabling the selective formation of enantiomerically pure compounds. Additionally, its incorporation into synthetic pathways can lead to the efficient production of target molecules with high yields and purities.Overall, (R)-Benzyl 3-hydroxypiperidine-1-carboxylate plays a crucial role in the synthesis of diverse organic compounds and serves as a valuable tool for chemists working in drug discovery, materials science, and molecular biology.