AA03860
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 98% | in stock | $22.00 | $15.00 | - + | |
25g | 98% | in stock | $30.00 | $21.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA03860 |
Chemical Name: | 4-Fluoro-3-nitrobenzonitrile |
CAS Number: | 1009-35-4 |
Molecular Formula: | C7H3FN2O2 |
Molecular Weight: | 166.10932320000003 |
MDL Number: | MFCD01632197 |
SMILES: | N#Cc1ccc(c(c1)[N+](=O)[O-])F |
Complexity: | 229 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
XLogP3: | 1.6 |
4-Fluoro-3-nitrobenzonitrile is a key intermediate in chemical synthesis, widely utilized in various organic transformations. This compound serves as a valuable building block for the preparation of diverse functional molecules due to its unique chemical properties. Specifically, 4-Fluoro-3-nitrobenzonitrile can undergo selective substitution reactions, enabling the introduction of different functional groups at specific positions on the benzene ring. This versatility makes it an essential component in the synthesis of pharmaceuticals, agrochemicals, and advanced materials. Moreover, its nitro and cyano groups provide handles for further derivatization, allowing for the generation of complex molecular structures. In addition, the presence of the fluoro substituent enhances the compound's reactivity and hydrophobicity, making it a valuable precursor for designing novel compounds with desired properties. Overall, the strategic incorporation of 4-Fluoro-3-nitrobenzonitrile in chemical synthesis enables the efficient construction of diverse molecular architectures with potential applications in various industries.
Journal of the American Chemical Society 20030219