logo
Home  > Phe-arg beta-naphthylamide dihydrochloride

AE21128

100929-99-5 | Phe-arg beta-naphthylamide dihydrochloride

Packsize Purity Availability Price Discounted Price    Quantity
5mg 98% in stock $67.00 $47.00 -   +
25mg 98% in stock $88.00 $62.00 -   +
100mg 98% in stock $269.00 $188.00 -   +
250mg 98% in stock $469.00 $328.00 -   +
1g 98% in stock $1,490.00 $1,043.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE21128
Chemical Name: Phe-arg beta-naphthylamide dihydrochloride
CAS Number: 100929-99-5
Molecular Formula: C25H32Cl2N6O2
Molecular Weight: 519.4665800000001
MDL Number: MFCD00058046
SMILES: NC(=N)NCCC[C@@H](C(=O)Nc1ccc2c(c1)cccc2)NC(=O)[C@H](Cc1ccccc1)N.Cl.Cl

 

Upstream Synthesis Route 
  • (S)-2-((S)-2-Amino-3-phenylpropanamido)-5-guanidino-N-(naphthalen-2-yl)pentanamide dihydrochloride is a versatile compound commonly used in chemical synthesis processes. This compound plays a crucial role in the development of pharmaceuticals, especially in the creation of new drug candidates. Its unique structure and properties make it an ideal building block for creating complex molecules with specific biological activities. In addition, this compound is utilized in the synthesis of peptide analogs and mimetics, where its guanidino and amido functional groups contribute to the formation of intricate molecular structures. The presence of the naphthalen-2-yl group further enhances the compound's stability and reactivity, making it a valuable tool in medicinal chemistry research and drug discovery efforts.
FEATURED PRODUCTS