logo
Home  > 2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-benzenemethanol

AA03973

1009303-77-8 | 2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-benzenemethanol

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% in stock $9.00 $6.00 -   +
250mg 97% in stock $15.00 $10.00 -   +
1g 97% in stock $20.00 $14.00 -   +
5g 97% in stock $99.00 $70.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA03973
Chemical Name: 2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-benzenemethanol
CAS Number: 1009303-77-8
Molecular Formula: C14H21BO4
Molecular Weight: 264.1251
MDL Number: MFCD13184694
SMILES: OCc1cc(ccc1OC)B1OC(C(O1)(C)C)(C)C

 

Upstream Synthesis Route 
  • 2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenemethanol, often used as a versatile reagent in chemical synthesis due to its valuable properties. This compound serves as a key building block in the creation of various organic compounds, particularly in the realm of medicinal chemistry and materials science. Its unique molecular structure enables it to participate in diverse reactions, such as Suzuki-Miyaura cross-coupling reactions and other C-C bond forming processes. Through its incorporation into synthetic pathways, this compound facilitates the creation of complex molecular structures with high precision and efficiency. Its application in chemical synthesis extends to the development of pharmaceuticals, agrochemicals, and other fine chemicals, highlighting its significance in modern synthetic chemistry methodologies.
FEATURED PRODUCTS