AA04228
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25g | 98% | in stock | $13.00 | $9.00 | - + | |
100g | 98% | in stock | $30.00 | $21.00 | - + | |
500g | 98% | in stock | $130.00 | $91.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA04228 |
Chemical Name: | N-Ethyl-n-benzylaniline-3'-sulfonic acid |
CAS Number: | 101-11-1 |
Molecular Formula: | C15H17NO3S |
Molecular Weight: | 291.3654 |
MDL Number: | MFCD00035761 |
SMILES: | CCN(c1ccccc1)Cc1cccc(c1)S(=O)(=O)O |
Complexity: | 384 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 5 |
XLogP3: | 2.7 |
In chemical synthesis, 3-((Ethyl(phenyl)amino)methyl)benzenesulfonic acid serves as a versatile building block for the preparation of various pharmaceuticals, agrochemicals, and fine chemicals. Its unique chemical structure allows for the introduction of both amine and sulfonic acid functional groups into target molecules, enabling the synthesis of complex organic compounds.This compound can be used as a key intermediate in the production of dyes, pigments, and fluorescent probes, where its sulfonic acid group provides water solubility and enhances the compound's reactivity in aqueous environments. Additionally, the ethyl(phenyl)amino moiety offers the potential for further derivatization through various chemical reactions, expanding the scope of its applications in organic synthesis.