AA04363
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA04363 |
Chemical Name: | Phosphoric acid, ammonium iron(2+) salt (1:1:1) |
CAS Number: | 10101-60-7 |
Molecular Formula: | FeH4NO4P |
Molecular Weight: | 168.8548 |
SMILES: | [O-]P(=O)([O-])[O-].[Fe+2].[NH4+] |
Ferrous ammonium phosphate is a versatile chemical compound that finds extensive applications in chemical synthesis. In particular, it is commonly used as a precursor in the production of various iron-based materials and inorganic compounds. One major utilization of ferrous ammonium phosphate is in the synthesis of iron phosphate, which is a vital component in the manufacturing of lithium iron phosphate batteries. These batteries are widely employed in electric vehicles and renewable energy storage systems due to their high energy density, long cycle life, and safety features.Furthermore, ferrous ammonium phosphate serves as a source of both iron and phosphate ions in the preparation of fertilizers. Iron is an essential nutrient for plant growth, while phosphate is vital for root development and overall plant health. By incorporating ferrous ammonium phosphate into fertilizer formulations, agricultural products can be tailored to enhance crop yield and quality.Additionally, this compound is utilized in laboratory settings to prepare iron-containing catalysts for organic chemical reactions. The presence of iron in catalysts can facilitate various transformations, including oxidation, reduction, and hydrogenation processes, leading to the efficient synthesis of organic compounds.In summary, ferrous ammonium phosphate is a valuable chemical reagent in various synthesis processes, ranging from the production of advanced materials to the development of high-performance catalysts and fertilizers. Its unique properties make it a crucial component in the chemical industry and scientific research endeavors.