AA04408
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25g | 98% | in stock | $6.00 | $4.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA04408 |
Chemical Name: | Sodium molybdate dihydrate |
CAS Number: | 10102-40-6 |
Molecular Formula: | H4MoNa2O6 |
Molecular Weight: | 241.9677 |
MDL Number: | MFCD00003486 |
SMILES: | [Na]O[Mo](=O)(=O)O[Na].O.O |
Complexity: | 62.2 |
Covalently-Bonded Unit Count: | 5 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Disodium molybdate dihydrate is a versatile chemical compound that finds widespread application in chemical synthesis processes. As a key ingredient, it serves as an essential catalyst in various reactions due to its unique properties. This compound is particularly valued for its ability to promote oxidation reactions, making it an important component in the production of various chemicals and materials. Its role as a catalyst in chemical synthesis allows for the efficient transformation of starting materials into desired products, enabling the synthesis of a wide range of organic and inorganic compounds. Additionally, Disodium molybdate dihydrate is known for its high purity and consistent quality, making it a reliable choice for researchers and industrial chemists alike in their synthetic endeavors.