logo
Home  > [2,2'-Bipyridine]-4,4'(1H,1'H)-dithione

AA04422

101028-40-4 | [2,2'-Bipyridine]-4,4'(1H,1'H)-dithione

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA04422
Chemical Name: [2,2'-Bipyridine]-4,4'(1H,1'H)-dithione
CAS Number: 101028-40-4
Molecular Formula: C10H8N2S2
Molecular Weight: 220.3139
MDL Number: MFCD08704190
SMILES: S=c1cc[nH]c(c1)c1[nH]ccc(=S)c1

 

Upstream Synthesis Route 
  • [2,2'-Bipyridine]-4,4'(1H,1'H)-dithione is a versatile compound widely used in chemical synthesis for its unique properties. This molecule is particularly prized for its ability to act as a strong chelating ligand, forming stable complexes with various metal ions. In organic synthesis, [2,2'-Bipyridine]-4,4'(1H,1'H)-dithione is employed as a key building block in the preparation of coordination compounds and catalysts. Its chelating properties play a crucial role in facilitating complex formation and promoting specific reactivity in a variety of chemical reactions. Additionally, this compound serves as a valuable tool in the development of new materials and the study of coordination chemistry. Its application in chemical synthesis extends to areas such as catalysis, molecular recognition, and materials science, making it an indispensable component in the toolkit of researchers and synthetic chemists.
FEATURED PRODUCTS