logo
Home  > Qunoxidine

AE24992

10103-89-6 | Qunoxidine

Packsize Purity Availability Price Discounted Price    Quantity
500mg 2 weeks $406.00 $285.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE24992
Chemical Name: Qunoxidine
CAS Number: 10103-89-6
Molecular Formula: C14H14N2O6
Molecular Weight: 306.2708
MDL Number: MFCD01106956
SMILES: CC(=O)OCC1=C(COC(=O)C)N([O-])c2c([N+]1=O)cccc2

 

Upstream Synthesis Route 
  • The compound 2,3-Quinoxalinedimethanol, 2,3-diacetate, 1,4-dioxide plays a crucial role in chemical synthesis as a versatile building block with diverse applications. With its unique structure, it serves as a valuable intermediate in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. This compound is particularly useful in the development of novel drug candidates, where its presence can impart desired pharmacological properties or enhance biological activity. Additionally, its reactivity in organic reactions makes it a key component in the preparation of complex organic molecules through multi-step synthesis strategies. Overall, the compound's role in chemical synthesis showcases its importance in driving innovation and advancement in the field of chemistry.
FEATURED PRODUCTS