logo
Home  > 4,4',4'',4''',4'''',4'''''-[[Ethane-1,1,1-triyltris(benzene-4,1-diyl)]tris(ethane-1,1,1-triyl)]hexaphenol

AX05541

1010447-10-5 | 4,4',4'',4''',4'''',4'''''-[[Ethane-1,1,1-triyltris(benzene-4,1-diyl)]tris(ethane-1,1,1-triyl)]hexaphenol

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% 2 weeks $298.00 $209.00 -   +
250mg 95% 2 weeks $348.00 $244.00 -   +
1g 95% 2 weeks $765.00 $535.00 -   +
5g 95% 2 weeks $1,896.00 $1,327.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AX05541
Chemical Name: 4,4',4'',4''',4'''',4'''''-[[Ethane-1,1,1-triyltris(benzene-4,1-diyl)]tris(ethane-1,1,1-triyl)]hexaphenol
CAS Number: 1010447-10-5
Molecular Formula: C62H54O6
Molecular Weight: 895.0886
MDL Number: MFCD30742683
SMILES: CC(c1ccc(cc1)C(c1ccc(cc1)O)(c1ccc(cc1)O)C)(c1ccc(cc1)C(c1ccc(cc1)O)(c1ccc(cc1)O)C)c1ccc(cc1)C(c1ccc(cc1)O)(c1ccc(cc1)O)C

 

Upstream Synthesis Route 
  • The 4,4',4'',4''',4'''',4'''''-[[ethane-1,1,1-triyltris(benzene-4,1-diyl)]tris(ethane-1,1,1-triyl)]hexaphenol compound plays a crucial role in chemical synthesis as a versatile building block. Its unique structure containing multiple phenol and benzene rings allows for a wide range of applications in organic chemistry. This compound can serve as a core component in the synthesis of complex molecules due to its ability to participate in various reactions and form intricate structures. In particular, it can act as a key intermediate in the creation of dendrimers, polymers, and other advanced materials, where precise control over molecular architecture is essential. Its structural complexity and functional groups make it a valuable tool for the construction of novel organic frameworks with tailored properties and functionalities.
FEATURED PRODUCTS