logo
Home  > Chemistry  > Organic Building Blocks  > Nitroes  > 3-Carboxy-5-nitrophenylboronic acid

AA04596

101084-81-5 | 3-Carboxy-5-nitrophenylboronic acid

Packsize Purity Availability Price Discounted Price    Quantity
1g 97% in stock $6.00 $5.00 -   +
5g 97% in stock $30.00 $21.00 -   +
10g 97% in stock $34.00 $24.00 -   +
25g 97% in stock $82.00 $58.00 -   +
100g 97% in stock $264.00 $185.00 -   +
500g 97% in stock $1,319.00 $923.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA04596
Chemical Name: 3-Carboxy-5-nitrophenylboronic acid
CAS Number: 101084-81-5
Molecular Formula: C7H6BNO6
Molecular Weight: 210.9366
MDL Number: MFCD00757433
SMILES: OB(c1cc(cc(c1)C(=O)O)[N+](=O)[O-])O

 

Computed Properties
Complexity: 265  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 15  
Hydrogen Bond Acceptor Count: 6  
Hydrogen Bond Donor Count: 3  
Rotatable Bond Count: 2  

 

 

Upstream Synthesis Route
  • 3-Borono-5-nitrobenzoic acid, also known as BNBA, is a versatile chemical compound widely used in chemical synthesis. As a boronic acid derivative, BNBA plays a crucial role in numerous organic reactions, particularly in Suzuki-Miyaura cross-coupling reactions. This powerful coupling reaction allows for the formation of carbon-carbon bonds under mild conditions, making it a valuable tool in the synthesis of complex organic compounds.Additionally, BNBA is utilized as a key building block in the preparation of various pharmaceuticals, agrochemicals, and advanced materials. Its unique structure and reactivity enable chemists to introduce functional groups with precision, enhancing the efficiency and selectivity of chemical transformations.Moreover, 3-Borono-5-nitrobenzoic acid exhibits promising potential in the development of new synthetic methodologies, such as C-H activation and metal-catalyzed transformations. Its ability to activate inert C-H bonds and participate in diverse chemical reactions makes it a valuable asset in the toolbox of synthetic chemists seeking to streamline complex molecule synthesis.In conclusion, 3-Borono-5-nitrobenzoic acid is a versatile and indispensable reagent in modern chemical synthesis, offering a wide range of applications and contributing to the advancement of organic chemistry.
FEATURED PRODUCTS