AA04673
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $20.00 | $14.00 | - + | |
1g | 95% | in stock | $41.00 | $29.00 | - + | |
5g | 95% | in stock | $86.00 | $61.00 | - + | |
10g | 95% | in stock | $163.00 | $114.00 | - + | |
25g | 95% | in stock | $359.00 | $252.00 | - + | |
50g | 95% | in stock | $655.00 | $458.00 | - + | |
100g | 95% | in stock | $1,277.00 | $894.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA04673 |
Chemical Name: | Cis-4-(methoxycarbonyl)cyclohexanecarboxylic acid |
CAS Number: | 1011-85-4 |
Molecular Formula: | C9H14O4 |
Molecular Weight: | 186.20506000000003 |
MDL Number: | MFCD01311246 |
SMILES: | COC(=O)[C@@H]1CC[C@@H](CC1)C(=O)O |
The cis-4-(Methoxycarbonyl)cyclohexanecarboxylic acid plays a crucial role in chemical synthesis as a versatile building block. Its unique structure and reactivity allow it to participate in a wide range of reactions, making it a valuable tool for organic chemists. This compound is commonly used as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals. Its strategic placement of functional groups enables facile modification and manipulation, facilitating the synthesis of complex molecules. By serving as a starting material for diverse transformations such as esterifications, amidations, and rearrangements, cis-4-(Methoxycarbonyl)cyclohexanecarboxylic acid offers synthetic chemists a powerful platform for creating novel compounds with potential biological activities or industrial applications.