AA04814
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 98% | in stock | $20.00 | $14.00 | - + | |
500mg | 98% | in stock | $101.00 | $71.00 | - + | |
1g | 98% | in stock | $171.00 | $120.00 | - + | |
5g | 98% | in stock | $509.00 | $356.00 | - + | |
10g | 98% | in stock | $888.00 | $622.00 | - + | |
25g | 98% | in stock | $1,775.00 | $1,242.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA04814 |
Chemical Name: | Milnacipran HCl |
CAS Number: | 101152-94-7 |
Molecular Formula: | C15H23ClN2O |
Molecular Weight: | 282.8089 |
MDL Number: | MFCD00901293 |
SMILES: | NCC1CC1(c1ccccc1)C(=O)N(CC)CC.Cl |
Complexity: | 295 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
Milnacipran hydrochloride is a versatile compound that finds its application in chemical synthesis as a key intermediate in the production of pharmaceuticals. With its unique chemical structure and properties, Milnacipran hydrochloride serves as a fundamental building block for the synthesis of various drugs, including antidepressants and analgesics. Its ability to undergo specific chemical reactions allows for the efficient and controlled formation of complex molecules, making it a valuable tool in the pharmaceutical industry. The incorporation of Milnacipran hydrochloride in chemical synthesis enables the creation of novel drug candidates with improved efficacy and reduced side effects, ultimately contributing to advancements in medicine and healthcare.