logo
Home  > 2,3,5,6-tetrafluorophenyl prop-2-enoate

AV16935

101156-32-5 | 2,3,5,6-tetrafluorophenyl prop-2-enoate

Packsize Purity Availability Price Discounted Price    Quantity
250mg 97% 1 week $90.00 $63.00 -   +
1g 97% 1 week $108.00 $76.00 -   +
5g 97% 1 week $282.00 $198.00 -   +
25g 97% 1 week $1,174.00 $822.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AV16935
Chemical Name: 2,3,5,6-tetrafluorophenyl prop-2-enoate
CAS Number: 101156-32-5
Molecular Formula: C9H4F4O2
Molecular Weight: 220.1205
MDL Number: MFCD00129957
SMILES: C=CC(=O)Oc1c(F)c(F)cc(c1F)F

 

Upstream Synthesis Route
  • 2,3,5,6-Tetrafluorophenyl Acrylate is a versatile chemical compound commonly utilized in chemical synthesis for its unique properties and applications. This acrylate derivative is valued for its ability to undergo various chemical reactions, making it an essential component in the preparation of functional polymers and advanced materials. In particular, 2,3,5,6-Tetrafluorophenyl Acrylate is frequently employed in the synthesis of polymers with tailored physical and chemical properties, including coatings, adhesives, and specialty polymers. Its use in polymer chemistry enables the modification of material surfaces to enhance properties such as adhesion, water resistance, and chemical stability. Additionally, this compound serves as a valuable building block in the development of novel organic molecules and pharmaceutical intermediates, showcasing its significance in the realm of modern synthetic chemistry.
FEATURED PRODUCTS