AA04988
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $20.00 | $14.00 | - + | |
1g | 95% | in stock | $70.00 | $49.00 | - + | |
5g | 95% | in stock | $235.00 | $164.00 | - + | |
10g | 95% | in stock | $468.00 | $327.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA04988 |
Chemical Name: | 4-(3-Bromoimidazo[1,2-b]pyridazin-6-yl)morpholine |
CAS Number: | 1012343-72-4 |
Molecular Formula: | C10H11BrN4O |
Molecular Weight: | 283.1245 |
MDL Number: | MFCD11520886 |
SMILES: | Brc1cnc2n1nc(cc2)N1CCOCC1 |
Complexity: | 249 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.4 |
The compound 4-(3-Bromoimidazo[1,2-b]pyridazin-6-yl)morpholine, named $name$, is a versatile building block in chemical synthesis. With its unique structure combining a bromoimidazo-pyridazinyl ring and a morpholine moiety, this compound exhibits valuable chemical reactivity and functional versatility.In organic synthesis, $name$ can serve as a key intermediate for the construction of complex molecular structures. The bromo substituent on the imidazo-pyridazinyl ring enables selective cross-coupling reactions with various nucleophiles, allowing for the introduction of diverse functional groups. Additionally, the presence of the morpholine group provides a handle for further derivatization through nucleophilic substitution or ring-opening reactions.Furthermore, the fused imidazo-pyridazinyl ring system in $name$ offers the potential for the development of novel bioactive compounds. This heterocyclic scaffold is recognized for its pharmacological importance, making $name$ a promising candidate for the synthesis of drug-like molecules with potential therapeutic applications.Overall, the strategic incorporation of 4-(3-Bromoimidazo[1,2-b]pyridazin-6-yl)morpholine in chemical synthesis enables access to a diverse array of functionalized molecules with potential biological activities, making it an indispensable tool for organic chemists seeking to explore new chemical space and drug discovery.