AA05118
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $165.00 | $115.00 | - + | |
1g | 95% | in stock | $523.00 | $366.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA05118 |
Chemical Name: | Diethyl 2-allyl-2-(prop-2-ynyl)malonate |
CAS Number: | 101268-55-7 |
Molecular Formula: | C13H18O4 |
Molecular Weight: | 238.2796 |
MDL Number: | MFCD00845709 |
SMILES: | C=CCC(C(=O)OCC)(C(=O)OCC)CC#C |
Diethyl 2-allyl-2-(prop-2-ynyl)malonate is a versatile compound widely used in chemical synthesis as a valuable building block for the production of various organic compounds. Its unique structure consisting of both allyl and propargyl functional groups offers a wide range of potential reactions and applications in organic chemistry.One prominent application of Diethyl 2-allyl-2-(prop-2-ynyl)malonate is in the synthesis of complex molecules through multi-step reactions. The allyl group can undergo allylic substitution reactions to introduce different functionalities, while the propargyl group can participate in alkyne-based reactions such as Sonogashira coupling or click chemistry. This compound's ability to undergo diverse transformations makes it a valuable tool for the synthesis of pharmaceuticals, natural products, and advanced materials.Furthermore, Diethyl 2-allyl-2-(prop-2-ynyl)malonate can serve as a synthetic intermediate for the construction of heterocyclic compounds, which are essential scaffolds in drug discovery and medicinal chemistry. By utilizing this compound in strategic synthetic routes, chemists can access structurally complex molecules with specific biological activities or material properties.In summary, Diethyl 2-allyl-2-(prop-2-ynyl)malonate plays a crucial role in chemical synthesis by serving as a versatile building block for the construction of intricate organic molecules with diverse functionalities and applications. Its flexibility and reactivity make it an indispensable tool for synthetic chemists striving to access novel compounds with tailored properties.