AA05134
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $7.00 | $5.00 | - + | |
5g | 98% | in stock | $16.00 | $12.00 | - + | |
10g | 98% | in stock | $30.00 | $21.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA05134 |
Chemical Name: | 2,4-Dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine |
CAS Number: | 1012785-51-1 |
Molecular Formula: | C6H2Cl2IN3 |
Molecular Weight: | 313.9106 |
MDL Number: | MFCD13189364 |
SMILES: | Clc1nc(Cl)c2c(n1)[nH]cc2I |
Complexity: | 182 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 3.2 |
2,4-Dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine is a versatile compound extensively utilized in chemical synthesis. Its unique structure allows it to serve as a crucial building block in the creation of various pharmaceuticals, agrochemicals, and functional materials. Within the realm of organic chemistry, this compound plays a pivotal role in the development of novel compounds and the modification of existing molecules. Its strategic incorporation in synthetic pathways enables chemists to access complex structures with high efficiency and precision. Furthermore, its chemical reactivity and distinct properties make it a valuable asset in the pursuit of innovative solutions in the field of chemical synthesis.