AA05160
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $25.00 | $17.00 | - + | |
5g | 95% | in stock | $52.00 | $36.00 | - + | |
10g | 95% | in stock | $96.00 | $67.00 | - + | |
25g | 95% | in stock | $151.00 | $106.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA05160 |
Chemical Name: | 11-Chloro-2,3-dihydro-2-methyl-1h-dibenz[2,3:6,7]oxepino[4,5-c]pyrrol-1-one |
CAS Number: | 1012884-46-6 |
Molecular Formula: | C17H12ClNO2 |
Molecular Weight: | 297.7357 |
MDL Number: | MFCD15145473 |
SMILES: | Clc1ccc2c(c1)C1=C(CN(C1=O)C)c1c(O2)cccc1 |
Complexity: | 489 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 2 |
XLogP3: | 2.9 |
The compound 11-Chloro-2-methyl-2,3-dihydro-1H-dibenzo[2,3:6,7]oxepino[4,5-c]pyrrol-1-one, also known as $name$, is a versatile building block in chemical synthesis. Its unique structure and functional groups make it a valuable intermediate in the creation of complex organic molecules. In the field of medicinal chemistry, $name$ can be utilized for the construction of various heterocyclic compounds with potential pharmacological activities. Its chloro and methyl substituents provide opportunities for further functionalization, allowing for the introduction of specific properties or functionalities into the final compounds. Additionally, $name$ can serve as a useful starting material for the synthesis of natural products, pharmaceuticals, and agrochemicals, showcasing its importance in the realm of organic synthesis.