AE11315
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98+% | in stock | $32.00 | $22.00 | - + | |
5mg | 98+% | in stock | $78.00 | $55.00 | - + | |
10mg | 98+% | in stock | $115.00 | $81.00 | - + | |
50mg | 98+% | in stock | $318.00 | $222.00 | - + | |
500mg | 95% | in stock | $2,536.00 | $1,775.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE11315 |
Chemical Name: | Pf-04691502 |
CAS Number: | 1013101-36-4 |
Molecular Formula: | C22H27N5O4 |
Molecular Weight: | 425.4809 |
MDL Number: | MFCD18782794 |
SMILES: | OCCO[C@@H]1CC[C@H](CC1)n1c(=O)c(cc2c1nc(N)nc2C)c1ccc(nc1)OC |
Complexity: | 654 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 31 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 6 |
XLogP3: | 1.6 |
European journal of cancer (Oxford, England : 1990) 20160301
Toxicology letters 20130704
Cancer chemotherapy and pharmacology 20120801
ACS medicinal chemistry letters 20111110
Molecular cancer therapeutics 20111101