logo
Home  > 4-Methyl-5-nitro-1h-indazole

AA05599

101420-67-1 | 4-Methyl-5-nitro-1h-indazole

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $40.00 $28.00 -   +
250mg 95% in stock $46.00 $32.00 -   +
1g 95% in stock $115.00 $80.00 -   +
5g 95% in stock $455.00 $319.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA05599
Chemical Name: 4-Methyl-5-nitro-1h-indazole
CAS Number: 101420-67-1
Molecular Formula: C8H7N3O2
Molecular Weight: 177.1601
MDL Number: MFCD03787902
SMILES: [O-][N+](=O)c1ccc2c(c1C)cn[nH]2

 

Upstream Synthesis Route 
  • 4-Methyl-5-nitro-1H-indazole is a key compound widely employed in chemical synthesis due to its unique properties and versatile applications. This compound serves as a crucial building block in the preparation of various pharmaceuticals, agrochemicals, and fine chemicals. Its nitro group is particularly valuable for introducing functional groups, facilitating further modification and derivatization. 4-Methyl-5-nitro-1H-indazole plays a crucial role as an intermediate in diverse synthetic routes, enabling the synthesis of novel compounds with enhanced biological activities or specific properties. Its strategic placement within molecular structures allows for the synthesis of complex molecules with precision, making it a valuable tool in modern organic chemistry research and development.
FEATURED PRODUCTS