logo
Home  > Life Science  > Peptides  > Peptide  > H-Gamma-glu-gln-oh

AA05743

10148-81-9 | H-Gamma-glu-gln-oh

Packsize Purity Availability Price Discounted Price    Quantity
5mg 95% in stock $58.00 $41.00 -   +
25mg 95% in stock $85.00 $60.00 -   +
100mg 95% in stock $97.00 $68.00 -   +
250mg 95% in stock $181.00 $127.00 -   +
1g 95% in stock $487.00 $341.00 -   +
5g 95% in stock $1,878.00 $1,315.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA05743
Chemical Name: H-Gamma-glu-gln-oh
CAS Number: 10148-81-9
Molecular Formula: C10H17N3O6
Molecular Weight: 275.2585
MDL Number: MFCD00038475
SMILES: O=C(N[C@H](C(=O)O)CCC(=O)N)CC[C@@H](C(=O)O)N

 

Computed Properties
Complexity: 370  
Covalently-Bonded Unit Count: 1  
Defined Atom Stereocenter Count: 2  
Heavy Atom Count: 19  
Hydrogen Bond Acceptor Count: 7  
Hydrogen Bond Donor Count: 5  
Rotatable Bond Count: 9  
XLogP3: -4.9  

 

 

Upstream Synthesis Route
  • - γ-Glutamylglutamine, also known as γ-L-glutamyl-L-glutamine, plays a crucial role in chemical synthesis due to its unique structure and properties.- In chemical synthesis, γ-Glutamylglutamine is commonly used as a building block for the production of peptides and proteins. Its dipeptide structure, consisting of glutamic acid and glutamine amino acids, makes it an important intermediate for the synthesis of larger, bioactive molecules.- γ-Glutamylglutamine is particularly valuable in peptide synthesis due to its stability and compatibility with various reagents and reaction conditions. Its presence can enhance the overall yield and efficiency of peptide synthesis reactions.- This dipeptide is utilized in the pharmaceutical and biotechnology industries for the production of peptide-based drugs, therapeutic agents, and research reagents. Its versatility in chemical synthesis makes it a valuable tool for creating complex molecular structures with precise control over stereochemistry and functionality.- By incorporating γ-Glutamylglutamine into chemical reactions, chemists can access a diverse range of peptide derivatives and analogs with tailored properties for specific applications in drug discovery, biomedical research, and materials science.
FEATURED PRODUCTS