AA05897
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 96% | in stock | $65.00 | $45.00 | - + | |
1g | 96% | in stock | $167.00 | $117.00 | - + | |
5g | 96% | in stock | $573.00 | $402.00 | - + | |
10g | 96% | in stock | $946.00 | $662.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA05897 |
Chemical Name: | 2-Piperidinopyrimidine-5-boronic acid pinacol ester |
CAS Number: | 1015242-08-6 |
Molecular Formula: | C15H24BN3O2 |
Molecular Weight: | 289.181 |
MDL Number: | MFCD07368250 |
SMILES: | CC1(C)OB(OC1(C)C)c1cnc(nc1)N1CCCCC1 |
Complexity: | 348 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 2 |
The compound $name$ serves as a versatile building block in chemical synthesis due to its unique structure and reactivity. It is commonly used as a key intermediate in the preparation of various pharmaceuticals, agrochemicals, and materials.In chemical synthesis, $name$ can be employed in Suzuki-Miyaura cross-coupling reactions to introduce the pyrimidine moiety into more complex molecules. Additionally, the boronic ester functionality of $name$ allows for further functionalization through various transformations such as oxidation, reduction, and substitution reactions, enabling the modification of its chemical properties.Furthermore, the presence of the dihydropyridine group in $name$ offers the potential for bioisosteric replacement in medicinal chemistry, making it a valuable scaffold for the design of novel drug candidates. Overall, the application of 2-(3,4-Dihydropyridin-1(2H)-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine in chemical synthesis demonstrates its significance in the creation of complex molecules with diverse functionalities and potential pharmacological activities.