AA05939
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA05939 |
Chemical Name: | Thymidine, α,α-difluoro- (9CI) |
CAS Number: | 101527-46-2 |
Molecular Formula: | C10H12F2N2O5 |
Molecular Weight: | 278.2095 |
MDL Number: | MFCD07781249 |
SMILES: | OC[C@H]1O[C@H](C[C@@H]1O)n1cc(C(F)F)c(=O)[nH]c1=O |
Thymidine, a,a-difluoro- (9CI) is a vital chemical compound widely utilized in organic synthesis processes. As a key building block, it plays a crucial role in the creation of various pharmaceuticals, agrochemicals, and materials. Its unique structure and properties make it an essential reagent in the development of advanced drug candidates and innovative chemical entities. Thymidine, a,a-difluoro- (9CI) enables chemists to introduce specific functional groups with precision, facilitating the synthesis of complex molecules with enhanced biological activities and tailored characteristics. In the realm of chemical synthesis, this compound serves as a valuable tool for researchers and industry professionals striving to push the boundaries of science and technology.