AA05971
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $9.00 | $6.00 | - + | |
1g | 98% | in stock | $20.00 | $14.00 | - + | |
5g | 98% | in stock | $76.00 | $53.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA05971 |
Chemical Name: | Potassium 1-methyl-4-trifluoroboratomethylpiperazine |
CAS Number: | 1015484-22-6 |
Molecular Formula: | C6H13BF3KN2 |
Molecular Weight: | 220.0853 |
MDL Number: | MFCD10700160 |
SMILES: | F[B-](CN1CCN(CC1)C)(F)F.[K+] |
Complexity: | 147 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 6 |
Rotatable Bond Count: | 1 |
To synthesize Potassium 1-methyl-4-trifluoroboratomethylpiperazine, commence with the readily available starting material piperazine. Proceed with the following steps: 1. N-Methylation of Piperazine: Treat piperazine with a methylating agent like methyl iodide (CH3I) under basic conditions to introduce the methyl group onto the nitrogen, yielding 1-methylpiperazine. 2. Generation of 4-Chloromethylpiperazine: Perform a nucleophilic substitution by reacting 1-methylpiperazine with chloromethyl chloride (CH2Cl2) to install the chloromethyl group at the 4-position, forming 4-chloromethyl-1-methylpiperazine. 3. Formation of 4-Trifluoroboratomethylpiperazine: Utilize a boron-trifluoride donor, such as sodium tetrafluoroborate (NaBF4), and replace the chlorine atom on the chloromethyl group with a trifluoroborate group by nucleophilic substitution. 4. Exchange to Potassium Salt: Replace the sodium counterion with potassium by treating the resultant trifluoroboratomethyl compound with a potassium salt, such as potassium carbonate (K2CO3), to yield the final product Potassium 1-methyl-4-trifluoroboratomethylpiperazine. Ensure purification between each step utilizing appropriate methods like recrystallization or chromatography to obtain the final desired compound with high purity.