AA05976
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $14.00 | $10.00 | - + | |
1g | 98% | in stock | $14.00 | $10.00 | - + | |
5g | 98% | in stock | $46.00 | $32.00 | - + | |
25g | 98% | in stock | $138.00 | $97.00 | - + | |
100g | 98% | in stock | $377.00 | $264.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA05976 |
Chemical Name: | Fmoc-d-pipecolic acid |
CAS Number: | 101555-63-9 |
Molecular Formula: | C21H21NO4 |
Molecular Weight: | 351.3957 |
MDL Number: | MFCD00235899 |
SMILES: | OC(=O)[C@H]1CCCCN1C(=O)OCC1c2ccccc2-c2c1cccc2 |
Complexity: | 514 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 3.7 |
The compound (2R)-1-[[(9H-Fluoren-9-yl)methoxy]carbonyl]piperidine-2-carboxylic acid, often referred to simply as $name$, serves as a versatile building block in chemical synthesis. With its unique structure combining a piperidine ring, a fluorenyl group, and a carboxylic acid functionality, this compound finds application in various synthetic pathways for the preparation of complex organic molecules.One key use of $name$ in chemical synthesis is as a chiral auxiliary or a chiral ligand. Its 2R configuration imparts chirality to the molecules it is incorporated into, allowing for the control and manipulation of stereochemistry during synthetic transformations. By leveraging the piperidine-2-carboxylic acid moiety for coordination with metal catalysts or as a directing group in reactions, chemists can selectively synthesize enantiomerically pure compounds, essential in the pharmaceutical and agrochemical industries.Furthermore, the fluorenyl-methoxy-carbonyl group attached to the piperidine ring offers protection to reactive functionalities during multi-step synthesis. This protective group can be selectively cleaved under mild conditions, allowing for strategic deprotection and unveiling of desired functional groups at specific stages of a synthetic route.Overall, the strategic placement and unique structural features of $name$ make it a valuable tool in organic synthesis, enabling chemists to access diverse chemical space and address the challenges of stereochemical control and functional group manipulation in complex molecule assembly.