AA06050
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $19.00 | $13.00 | - + | |
10mg | 95% | in stock | $46.00 | $32.00 | - + | |
25mg | 95% | in stock | $56.00 | $40.00 | - + | |
50mg | 95% | in stock | $67.00 | $47.00 | - + | |
100mg | 95% | in stock | $105.00 | $73.00 | - + | |
250mg | 95% | in stock | $218.00 | $152.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA06050 |
Chemical Name: | Benzoic acid, 4-hydroxy-, 2-[[4-(1-methylethyl)phenyl]methylene]hydrazide |
CAS Number: | 101574-65-6 |
Molecular Formula: | C17H18N2O2 |
Molecular Weight: | 282.33702 |
MDL Number: | MFCD00567155 |
SMILES: | Oc1ccc(cc1)C(=O)N/N=C/c1ccc(cc1)C(C)C |
Complexity: | 352 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 3.3 |
Toxicology 20120127
Journal of medicinal chemistry 20111110
The Journal of biological chemistry 20100716
Molecular and cellular endocrinology 20100205
Molecular and cellular endocrinology 20100205
Journal of combinatorial chemistry 20090101
The Journal of biological chemistry 20061208
Journal of medicinal chemistry 20050505