logo
Home  > 4-(4-Methoxyphenyl)-1,3-dimethyl-1h-pyrazol-5-amine

AA06130

1015846-18-0 | 4-(4-Methoxyphenyl)-1,3-dimethyl-1h-pyrazol-5-amine

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $35.00 $24.00 -   +
5g 95% in stock $83.00 $58.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA06130
Chemical Name: 4-(4-Methoxyphenyl)-1,3-dimethyl-1h-pyrazol-5-amine
CAS Number: 1015846-18-0
Molecular Formula: C12H15N3O
Molecular Weight: 217.267
MDL Number: MFCD09055260
SMILES: COc1ccc(cc1)c1c(C)nn(c1N)C

 

Upstream Synthesis Route
  • 4-(4-Methoxyphenyl)-1,3-dimethyl-1H-pyrazol-5-amine is a versatile compound widely utilized in chemical synthesis as a key building block. This specific molecule plays a crucial role in the synthesis of various pharmaceuticals, agrochemicals, and other fine chemicals due to its unique structural properties and reactivity. With its distinct amine and pyrazole functionalities, this compound serves as a valuable intermediate for the production of diverse organic molecules. It is frequently employed in the preparation of biologically active compounds, such as potential drug candidates and specialized chemicals used in research and development. The presence of the 4-methoxyphenyl group enhances the compound's interactions with biological targets, making it particularly valuable for medicinal chemistry applications. Additionally, the dimethyl substitution on the pyrazole ring contributes to the compound's stability and reactivity in various synthetic pathways. Overall, 4-(4-Methoxyphenyl)-1,3-dimethyl-1H-pyrazol-5-amine is an essential component in the toolbox of synthetic chemists for generating novel molecules with significant biological or chemical activities.
FEATURED PRODUCTS