logo
Home  > Pyrazolo[1,5-a]pyrimidine-5-carboxylic acid, 2,7-dimethyl-

AA06155

1015846-86-2 | Pyrazolo[1,5-a]pyrimidine-5-carboxylic acid, 2,7-dimethyl-

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $235.00 $164.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA06155
Chemical Name: Pyrazolo[1,5-a]pyrimidine-5-carboxylic acid, 2,7-dimethyl-
CAS Number: 1015846-86-2
Molecular Formula: C9H9N3O2
Molecular Weight: 191.1867
MDL Number: MFCD09971320
SMILES: Cc1nn2c(c1)nc(cc2C)C(=O)O

 

Upstream Synthesis Route 
  • 2,7-Dimethylpyrazolo[1,5-a]pyrimidine-5-carboxylic acid plays a crucial role in chemical synthesis as a versatile building block. This compound is commonly utilized in the production of various organic molecules with significant pharmaceutical and industrial applications. One of the main uses of 2,7-Dimethylpyrazolo[1,5-a]pyrimidine-5-carboxylic acid is as a key intermediate in the synthesis of bioactive compounds and pharmaceutical drugs. Its unique structure allows for the modification of functional groups, enabling the creation of diverse compounds with specific properties. Additionally, this compound is often employed in the development of new materials and specialty chemicals due to its reactivity and ability to participate in various chemical transformations.
FEATURED PRODUCTS