AA06220
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $7.00 | $5.00 | - + | |
5g | 98% | in stock | $17.00 | $12.00 | - + | |
10g | 98% | in stock | $32.00 | $22.00 | - + | |
25g | 98% | in stock | $71.00 | $50.00 | - + | |
100g | 98% | in stock | $263.00 | $184.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA06220 |
Chemical Name: | Dibenzothiophene sulfone |
CAS Number: | 1016-05-3 |
Molecular Formula: | C12H8O2S |
Molecular Weight: | 216.2557 |
MDL Number: | MFCD00004970 |
SMILES: | O=S1(=O)c2ccccc2c2c1cccc2 |
Complexity: | 313 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 2 |
XLogP3: | 2.4 |
Bioorganic & medicinal chemistry letters 20120215
Macromolecular rapid communications 20110701
The Journal of chemical physics 20110128
The Journal of organic chemistry 20101015
Chemical communications (Cambridge, England) 20100714
The journal of physical chemistry. B 20080529
The Journal of organic chemistry 20050916
Chemical communications (Cambridge, England) 20050721
Chemical research in toxicology 20050601
Research in microbiology 20030401
Microbiology (Reading, England) 19970901
Nature biotechnology 19961201