AA06282
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $60.00 | $42.00 | - + | |
250mg | 95% | in stock | $90.00 | $63.00 | - + | |
1g | 95% | in stock | $251.00 | $176.00 | - + | |
5g | 95% | in stock | $713.00 | $499.00 | - + | |
10g | 95% | in stock | $1,179.00 | $825.00 | - + | |
25g | 95% | in stock | $2,112.00 | $1,479.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA06282 |
Chemical Name: | 4-Bromo-2,3,5,6-tetrafluorophenylboronic acid |
CAS Number: | 1016231-40-5 |
Molecular Formula: | C6H2BBrF4O2 |
Molecular Weight: | 272.7875 |
MDL Number: | MFCD05664311 |
SMILES: | Fc1c(F)c(B(O)O)c(c(c1Br)F)F |
Complexity: | 194 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
4-Bromo-2,3,5,6-tetrafluorophenyl)boronic acid is a versatile compound frequently utilized in chemical synthesis due to its unique properties. This chemical is commonly employed as a key building block in the synthesis of various pharmaceuticals, agrochemicals, and materials. Its boronic acid functionality allows for the formation of stable covalent bonds with organic molecules, enabling the construction of complex molecular structures. Additionally, the presence of bromine and fluorine substituents imparts specific reactivity and selectivity that are crucial in the construction of intricate chemical scaffolds. Overall, the application of (4-Bromo-2,3,5,6-tetrafluorophenyl)boronic acid in chemical synthesis enables researchers to access a diverse array of structurally and functionally diverse compounds with potential applications in various fields.