logo
Home  > 4-Bromo-2,3,5,6-tetrafluorophenylboronic acid

AA06282

1016231-40-5 | 4-Bromo-2,3,5,6-tetrafluorophenylboronic acid

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $60.00 $42.00 -   +
250mg 95% in stock $90.00 $63.00 -   +
1g 95% in stock $251.00 $176.00 -   +
5g 95% in stock $713.00 $499.00 -   +
10g 95% in stock $1,179.00 $825.00 -   +
25g 95% in stock $2,112.00 $1,479.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA06282
Chemical Name: 4-Bromo-2,3,5,6-tetrafluorophenylboronic acid
CAS Number: 1016231-40-5
Molecular Formula: C6H2BBrF4O2
Molecular Weight: 272.7875
MDL Number: MFCD05664311
SMILES: Fc1c(F)c(B(O)O)c(c(c1Br)F)F

 

Computed Properties
Complexity: 194  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 14  
Hydrogen Bond Acceptor Count: 6  
Hydrogen Bond Donor Count: 2  
Rotatable Bond Count: 1  

 

 

Upstream Synthesis Route
  • 4-Bromo-2,3,5,6-tetrafluorophenyl)boronic acid is a versatile compound frequently utilized in chemical synthesis due to its unique properties. This chemical is commonly employed as a key building block in the synthesis of various pharmaceuticals, agrochemicals, and materials. Its boronic acid functionality allows for the formation of stable covalent bonds with organic molecules, enabling the construction of complex molecular structures. Additionally, the presence of bromine and fluorine substituents imparts specific reactivity and selectivity that are crucial in the construction of intricate chemical scaffolds. Overall, the application of (4-Bromo-2,3,5,6-tetrafluorophenyl)boronic acid in chemical synthesis enables researchers to access a diverse array of structurally and functionally diverse compounds with potential applications in various fields.
FEATURED PRODUCTS