logo
Home  > 1-tert-Butyl 4-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate

AA06269

1016258-69-7 | 1-tert-Butyl 4-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $35.00 $24.00 -   +
1g 95% in stock $37.00 $26.00 -   +
5g 95% in stock $184.00 $129.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA06269
Chemical Name: 1-tert-Butyl 4-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate
CAS Number: 1016258-69-7
Molecular Formula: C14H26N2O4
Molecular Weight: 286.36724000000004
MDL Number: MFCD14525454
SMILES: CCOC(=O)C1(CN)CCN(CC1)C(=O)OC(C)(C)C

 

Upstream Synthesis Route 
  • 1-tert-Butyl 4-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate finds significant utility in chemical synthesis as a versatile building block. It serves as a key intermediate in the creation of complex organic molecules due to its unique structure and reactivity. This compound is particularly valued for its ability to introduce specific functional groups with precision, enabling the synthesis of diverse compounds such as pharmaceutical agents, agrochemicals, and advanced materials. Its incorporation in multistep synthesis processes can facilitate the formation of intricate molecular architectures, making it an essential component in the development of novel compounds with tailored properties and applications.
FEATURED PRODUCTS