logo
Home  > Chemistry  > Organic Building Blocks  > Nitroes  > 3,4-Difluoro-5-nitrobenzotrifluoride

AA06298

101646-01-9 | 3,4-Difluoro-5-nitrobenzotrifluoride

Packsize Purity Availability Price Discounted Price    Quantity
1g 98% in stock $249.00 $175.00 -   +
5g 98% in stock $712.00 $498.00 -   +
10g 98% in stock $1,178.00 $824.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA06298
Chemical Name: 3,4-Difluoro-5-nitrobenzotrifluoride
CAS Number: 101646-01-9
Molecular Formula: C7H2F5NO2
Molecular Weight: 227.0883
MDL Number: MFCD00236668
SMILES: [O-][N+](=O)c1cc(cc(c1F)F)C(F)(F)F

 

Computed Properties
Complexity: 251  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 15  
Hydrogen Bond Acceptor Count: 7  
XLogP3: 2.8  

 

 

Upstream Synthesis Route
  • 1,2-Difluoro-3-nitro-5-(trifluoromethyl)benzene is a versatile compound commonly employed in chemical synthesis for its unique properties and diverse applications. This compound serves as a valuable building block in the synthesis of various organic compounds, owing to its distinct structure and reactivity.The presence of both nitro and fluoro substituents in 1,2-Difluoro-3-nitro-5-(trifluoromethyl)benzene imparts specific chemical properties that make it useful in a range of synthetic processes. The trifluoromethyl group, combined with the nitro and difluoro functionalities, allows for selective chemical transformations and precise modifications to be carried out in a synthetic scheme.In chemical synthesis, 1,2-Difluoro-3-nitro-5-(trifluoromethyl)benzene can be utilized as a key intermediate for the preparation of pharmaceuticals, agrochemicals, and materials with desired properties. Its unique structure enables the introduction of fluorine atoms into organic molecules, which can significantly influence the physicochemical properties of the final products.Furthermore, the presence of the nitro group in 1,2-Difluoro-3-nitro-5-(trifluoromethyl)benzene enables it to participate in various synthetic reactions, such as nitration, reduction, and functional group interconversions, expanding its utility in diverse synthetic routes. This compound's versatility and reactivity make it a valuable tool for chemists seeking to design and synthesize complex organic molecules efficiently.Overall, 1,2-Difluoro-3-nitro-5-(trifluoromethyl)benzene plays a crucial role in chemical synthesis by serving as a strategic building block for the construction of novel organic compounds with tailored properties and functionalities. Its application in synthetic chemistry highlights its significance as a versatile precursor in the preparation of a wide variety of functional molecules.
FEATURED PRODUCTS