AA06420
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $63.00 | $44.00 | - + | |
250mg | 95% | in stock | $105.00 | $73.00 | - + | |
1g | 95% | in stock | $249.00 | $175.00 | - + | |
5g | 95% | in stock | $859.00 | $602.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA06420 |
Chemical Name: | 4-Methylsulfinylphenylboronic acid, pinacol ester |
CAS Number: | 1016641-70-5 |
Molecular Formula: | C13H19BO3S |
Molecular Weight: | 266.1642 |
MDL Number: | MFCD16660301 |
SMILES: | CS(=O)c1ccc(cc1)B1OC(C(O1)(C)C)(C)C |
Complexity: | 319 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 2 |
Undefined Atom Stereocenter Count: | 1 |
4,4,5,5-Tetramethyl-2-(4-(methylsulfinyl)phenyl)-1,3,2-dioxaborolane, also known as $name$, is a versatile compound widely used in chemical synthesis. Due to its unique structure and properties, this compound serves as a valuable building block in organic chemistry. $name$ is commonly employed as a boronic acid derivative in various cross-coupling reactions, particularly in the field of Suzuki-Miyaura coupling. This compound is effectively utilized to form carbon-carbon bonds, enabling the synthesis of complex organic molecules. Additionally, $name$ finds application in the preparation of pharmaceutical intermediates, agrochemicals, and materials science. Its ability to participate in diverse chemical transformations makes it an essential tool for researchers and synthetic chemists seeking to construct intricate molecular structures efficiently and with high precision.