AA06598
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 96% | 2 weeks | $908.00 | $635.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA06598 |
Chemical Name: | Sulfocostunolide A |
CAS Number: | 1016983-51-9 |
Molecular Formula: | C15H20O5S |
Molecular Weight: | 312.3813 |
MDL Number: | MFCD20260335 |
SMILES: | O=C1O[C@H]2[C@H]([C@@H]1CS(=O)(=O)O)CCC(=C)[C@H]1[C@@H]2C(=C)CC1 |
Sulfocostunolide A, a natural product derived from costunolide, serves as a versatile building block in chemical synthesis due to its unique structure and reactivity. This compound is particularly valued in organic chemistry for its ability to participate in various key transformations, including Michael additions, aldol reactions, and cycloadditions. When employed in synthetic routes, Sulfocostunolide A can enable the creation of complex molecular frameworks with high efficiency and selectivity. Its strategic use as a chiral synthon opens up opportunities for the preparation of diverse bioactive molecules, pharmaceutical intermediates, and natural product analogs. The incorporation of Sulfocostunolide A into synthetic strategies showcases its significant potential as a valuable tool for advancing the field of chemical synthesis.