AA06597
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA06597 |
Chemical Name: | Ferrocene, 1-(dicyclohexylphosphino)-2-[(R)-(dimethylamino)[2-(diphenylphosphino)phenyl]methyl]-, (1S)- |
CAS Number: | 1016985-24-2 |
Molecular Formula: | C43H51FeNP2 |
Molecular Weight: | 699.6643 |
MDL Number: | MFCD08561118 |
SMILES: | CN(C([C]12=[CH]3[CH]4=[CH]5[C-]1(P(C1CCCCC1)C1CCCCC1)[Fe+2]16782345[CH-]2[CH]1=[CH]7[CH]8=[CH]62)c1ccccc1P(c1ccccc1)c1ccccc1)C |
The (RP)-1-Dicyclohexylphosphino-2-[(R)-α-(dimethylamino)-2-(dicyclohexylphosphino)benzyl]ferrocene is a versatile compound widely employed in chemical synthesis processes. This complex plays a critical role as a chiral ligand in various asymmetric catalytic reactions due to its unique structural properties. It is particularly valued in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals where enantioselective transformations are essential for the desired outcome. The compound's ability to facilitate asymmetric transformations with high efficiency and selectivity makes it a valuable tool for chemists seeking to access optically pure compounds in their research and development endeavors. Its application in catalysis has significantly advanced the field of asymmetric synthesis and enabled the creation of new molecules with improved biological activities and properties.