AA06618
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $105.00 | $74.00 | - + | |
5g | 97% | in stock | $297.00 | $208.00 | - + | |
10g | 97% | in stock | $448.00 | $314.00 | - + | |
25g | 97% | in stock | $758.00 | $531.00 | - + | |
100g | 97% | in stock | $1,878.00 | $1,315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA06618 |
Chemical Name: | 5-Methyl-2-[(methylsulfonyl)amino]benzoic acid |
CAS Number: | 1017051-55-6 |
Molecular Formula: | C9H11NO4S |
Molecular Weight: | 229.2529 |
MDL Number: | MFCD09945630 |
SMILES: | Cc1ccc(c(c1)C(=O)O)NS(=O)(=O)C |
Complexity: | 333 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.1 |
5-Methyl-2-(methylsulfonamido)benzoic acid is a versatile compound widely used in chemical synthesis for its unique properties and diverse applications. This compound is commonly employed as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and organic compounds. Its sulfonamide group provides a reactive site for further modifications, making it a valuable building block in organic chemistry. Additionally, 5-Methyl-2-(methylsulfonamido)benzoic acid can be utilized in the development of novel materials, such as polymers and catalysts, due to its functional groups and structural features. Its compatibility with a wide range of reaction conditions and ability to undergo various transformations make it an essential component in the toolbox of synthetic chemists.