AA06695
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA06695 |
Chemical Name: | Methyl 3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-5-carboxylate |
CAS Number: | 1017273-31-2 |
Molecular Formula: | C10H9NO4 |
Molecular Weight: | 207.1828 |
MDL Number: | MFCD11878412 |
SMILES: | COC(=O)c1cccc2c1NC(=O)CO2 |
In chemical synthesis, Methyl 3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-5-carboxylate serves as a versatile building block for the creation of various organic compounds. With its unique structure and functional groups, this compound can undergo a range of reactions to form new molecules with diverse properties. Its carbonyl group can participate in nucleophilic addition reactions, enabling the introduction of different functional groups at that position. The presence of the ester group provides opportunities for esterification or transesterification reactions, leading to the modification of the molecule's side chains. Additionally, the benzooxazine ring system can undergo ring-opening reactions or further functionalization, expanding the chemical space that can be explored in the synthesis of complex organic compounds. Through strategic manipulation of the different reactive sites on Methyl 3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-5-carboxylate, chemists can design and synthesize novel molecules with tailored structures and properties for various applications in the fields of pharmaceuticals, materials science, and organic chemistry.