AV43908
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 1 week | $569.00 | $398.00 | - + | |
100mg | 95% | 1 week | $808.00 | $566.00 | - + | |
250mg | 95% | 1 week | $1,122.00 | $786.00 | - + | |
500mg | 95% | 1 week | $1,722.00 | $1,205.00 | - + | |
1g | 95% | 1 week | $2,186.00 | $1,530.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AV43908 |
Chemical Name: | 6-Methyl-2-oxo-5-phenyl-1,2-dihydropyridine-3-carboxylic acid |
CAS Number: | 10176-79-1 |
Molecular Formula: | C13H11NO3 |
Molecular Weight: | 229.2313 |
MDL Number: | MFCD22375125 |
SMILES: | OC(=O)c1cc(c2ccccc2)c([nH]c1=O)C |
2-Hydroxy-6-methyl-5-phenylnicotinic acid, also known as $name$, is a versatile compound widely utilized in chemical synthesis processes. This organic acid derivative plays a crucial role as a building block in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structural properties make it an excellent precursor for synthesizing complex molecules with specific functionalities.In chemical synthesis, $name$ can serve as a key intermediate in the production of novel drug compounds due to its ability to participate in diverse chemical reactions. By leveraging the hydroxyl, methyl, and phenyl groups present in its structure, chemists can modify and functionalize $name$ to introduce specific characteristics or enhance biological activity in the final product. The presence of the hydroxyl group, in particular, enables facile derivatization, allowing for the introduction of diverse substituents to tailor the compound for various applications.Moreover, the strategic positioning of the functional groups in 2-Hydroxy-6-methyl-5-phenylnicotinic acid makes it an attractive candidate for designing molecular scaffolds with potential pharmacological properties. By incorporating this compound into synthetic pathways, chemists can access structurally diverse chemical libraries that may lead to the discovery of new therapeutic agents or agrochemicals with improved efficacy and selectivity.Overall, the application of 2-Hydroxy-6-methyl-5-phenylnicotinic acid in chemical synthesis underscores its significance as a valuable building block in the development of innovative compounds across different industries. Whether in drug discovery, agrochemical research, or materials science, this compound offers a versatile platform for creating complex molecules with tailored properties and applications.