AA06860
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $89.00 | $62.00 | - + | |
1g | 98% | in stock | $235.00 | $164.00 | - + | |
5g | 98% | in stock | $823.00 | $576.00 | - + | |
10g | 98% | in stock | $1,443.00 | $1,010.00 | - + | |
25g | 98% | in stock | $2,873.00 | $2,011.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA06860 |
Chemical Name: | Methyl 5-phenylnicotinate |
CAS Number: | 10177-13-6 |
Molecular Formula: | C13H11NO2 |
Molecular Weight: | 213.23194000000004 |
MDL Number: | MFCD06802742 |
SMILES: | COC(=O)c1cncc(c1)c1ccccc1 |
Complexity: | 236 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.3 |
Methyl 5-phenylnicotinate is a versatile compound widely utilized in chemical synthesis due to its unique reactivity and functional group compatibility. This compound serves as a valuable building block in the creation of various organic molecules, especially in the pharmaceutical and agrochemical industries.One of the key applications of Methyl 5-phenylnicotinate is its role as a precursor in the synthesis of heterocyclic compounds. By participating in different chemical reactions, such as nucleophilic substitution, oxidation, and reduction, this compound can be transformed into diverse intermediates with varied functionalities. These intermediates can then be further modified to produce complex molecules with specific biological activities.Furthermore, Methyl 5-phenylnicotinate acts as a crucial component in the development of drug candidates and synthetic pathways. Its compatibility with a range of functional groups allows for strategic modifications during the synthesis of pharmaceuticals, enabling the introduction of desired properties and enhancing the pharmacological profile of the final products. In addition, the incorporation of Methyl 5-phenylnicotinate into the molecular structure of agrochemicals has shown promising results in enhancing their efficacy and selectivity against target pests or pathogens.Overall, Methyl 5-phenylnicotinate plays a fundamental role in chemical synthesis by enabling the construction of complex organic molecules with specific applications in the fields of pharmaceuticals and agrochemicals. Its versatility and reactivity make it a valuable tool for synthetic chemists seeking to design and develop novel compounds with tailored properties and activities.