logo
Home  > [5-(3-Methoxyphenyl)isoxazol-3-yl]acetic acid

AO83739

1018584-61-6 | [5-(3-Methoxyphenyl)isoxazol-3-yl]acetic acid

Packsize Purity Availability Price Discounted Price    Quantity
50mg 95% 3 weeks $491.00 $344.00 -   +
100mg 95% 3 weeks $558.00 $390.00 -   +
250mg 95% 3 weeks $650.00 $455.00 -   +
1000mg 95% 3 weeks $832.00 $583.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AO83739
Chemical Name: [5-(3-Methoxyphenyl)isoxazol-3-yl]acetic acid
CAS Number: 1018584-61-6
Molecular Formula: C12H11NO4
Molecular Weight: 233.22
MDL Number: MFCD10036162
SMILES: COc1cccc(c1)c1onc(c1)CC(=O)O

 

Upstream Synthesis Route 
  • The [5-(3-Methoxyphenyl)isoxazol-3-yl]acetic Acid plays a crucial role in chemical synthesis as a versatile building block. This compound is commonly used in the preparation of various pharmaceuticals, agrochemicals, and functional materials due to its unique structure and reactivity. Its isoxazole ring confers desirable properties for drug design, making it a valuable intermediate in the synthesis of biologically active compounds. Additionally, the acetic acid moiety provides a handle for further functionalization, enabling the modification of the molecule for specific applications. In chemical synthesis, this compound serves as a key component in the construction of complex organic molecules with tailored properties and activities. Through strategic manipulation of its structure, researchers can access a diverse array of compounds with potential therapeutic, agricultural, or materials-related benefits.
FEATURED PRODUCTS