AA07309
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $22.00 | $15.00 | - + | |
250mg | 95% | in stock | $28.00 | $19.00 | - + | |
1g | 95% | in stock | $44.00 | $31.00 | - + | |
10g | 95% | in stock | $431.00 | $302.00 | - + | |
25g | 95% | in stock | $738.00 | $517.00 | - + | |
100g | 95% | in stock | $1,878.00 | $1,315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA07309 |
Chemical Name: | 4,6-Dichloro-1h-indole-2-carboxylic acid |
CAS Number: | 101861-63-6 |
Molecular Formula: | C9H5Cl2NO2 |
Molecular Weight: | 230.0475 |
MDL Number: | MFCD00209870 |
SMILES: | Clc1cc(Cl)c2c(c1)[nH]c(c2)C(=O)O |
Complexity: | 249 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 3.2 |
4,6-Dichloroindole-2-carboxylic acid is a versatile compound widely used in chemical synthesis. Its unique structure and properties make it a valuable building block for the creation of various compounds in the field of organic chemistry. One of its primary applications is as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Its presence in the synthesis pathway allows for the formation of complex molecules with specific biological activities or desired properties. Additionally, 4,6-Dichloroindole-2-carboxylic acid can be utilized in the development of novel materials, dyes, and ligands for catalysis. Its ability to undergo diverse chemical transformations makes it a valuable tool for researchers and chemists working on the design and synthesis of new compounds for a wide range of applications.
Bioorganic & medicinal chemistry letters 20030616
Journal of medicinal chemistry 20030102