AA07295
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA07295 |
Chemical Name: | rel-(2R,4R)-1-tert-Butyl 2-methyl 4-aminopyrrolidine-1,2-dicarboxylate |
CAS Number: | 1018667-18-9 |
Molecular Formula: | C11H20N2O4 |
Molecular Weight: | 244.2875 |
MDL Number: | MFCD08704544 |
SMILES: | COC(=O)[C@H]1C[C@H](CN1C(=O)OC(C)(C)C)N |
The rel-(2R,4R)-1-tert-Butyl 2-methyl 4-aminopyrrolidine-1,2-dicarboxylate is a versatile compound used in chemical synthesis for the production of chiral building blocks, pharmaceutical intermediates, and complex molecules. It serves as a valuable starting material in the synthesis of various bioactive compounds due to its unique stereochemical arrangement and functional groups. This compound can be employed in asymmetric synthesis strategies to selectively form enantiomerically pure products, making it a valuable tool for medicinal chemistry and drug development. Additionally, its structural characteristics make it a key component in the preparation of advanced materials and catalysts.