AA07367
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10mg | 98% | in stock | $15.00 | $10.00 | - + | |
25mg | 98% | in stock | $18.00 | $12.00 | - + | |
50mg | 98% | in stock | $22.00 | $15.00 | - + | |
100mg | 98% | in stock | $26.00 | $18.00 | - + | |
250mg | 98% | in stock | $32.00 | $22.00 | - + | |
1g | 98% | in stock | $60.00 | $42.00 | - + | |
5g | 98% | in stock | $189.00 | $132.00 | - + | |
10g | 98% | in stock | $326.00 | $228.00 | - + | |
25g | 98% | in stock | $806.00 | $564.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA07367 |
Chemical Name: | (2S,3R,4R,5S,6R)-2-(4-Chloro-3-(4-ethoxybenzyl)phenyl)-6-(methylthio)tetrahydro-2h-pyran-3,4,5-triol |
CAS Number: | 1018899-04-1 |
Molecular Formula: | C21H25ClO5S |
Molecular Weight: | 424.9382 |
MDL Number: | MFCD22493506 |
SMILES: | CCOc1ccc(cc1)Cc1cc(ccc1Cl)[C@@H]1O[C@H](SC)[C@H]([C@@H]([C@H]1O)O)O |
The compound (2S,3R,4R,5S,6R)-2-(4-Chloro-3-(4-ethoxybenzyl)phenyl)-6-(methylthio)tetrahydro-2H-pyran-3,4,5-triol is a versatile building block utilized in chemical synthesis. This compound can be employed in the synthesis of various pharmaceuticals, agrochemicals, and materials due to its unique structure and functional groups. Its stereochemistry and specific substituents make it an important intermediate in the preparation of bioactive molecules with potential therapeutic value. In addition, the presence of the chloro and ethoxybenzyl groups provides opportunities for further derivatization to tailor the compound for specific applications in organic synthesis.