AV26409
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 90% | 3 weeks | $351.00 | $246.00 | - + | |
100mg | 90% | 3 weeks | $420.00 | $294.00 | - + | |
250mg | 90% | 3 weeks | $494.00 | $346.00 | - + | |
500mg | 90% | 3 weeks | $732.00 | $513.00 | - + | |
1g | 90% | 3 weeks | $965.00 | $675.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AV26409 |
Chemical Name: | N-(1-{5-methyl-1-[5-(trifluoromethyl)pyridin-2-yl]-1H-pyrazol-4-yl}ethylidene)hydroxylamine |
CAS Number: | 1019075-45-6 |
Molecular Formula: | C12H11F3N4O |
Molecular Weight: | 284.2371 |
MDL Number: | MFCD09802070 |
SMILES: | ON=C(c1cnn(c1C)c1ccc(cn1)C(F)(F)F)C |
The compound N-(1-{5-Methyl-1-[5-(trifluoromethyl)pyridin-2-yl]-1H-pyrazol-4-yl}ethylidene)hydroxylamine, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block. Its unique chemical structure allows for selective reactions and functional group transformations, making it valuable for creating complex organic molecules.In chemical synthesis, $name$ can be utilized as a key intermediate in the formation of various heterocyclic compounds. Its reactive functional groups enable it to participate in a range of reactions, including condensations, substitutions, and cyclizations. By incorporating $name$ into a synthesis pathway, chemists can access a diverse array of structurally diverse compounds with potential applications in pharmaceuticals, agrochemicals, and materials science.$name$ offers chemists a strategic tool for designing and constructing molecules with specific properties and functions. Its presence in a synthetic scheme can enable the precise control of stereochemistry and regioselectivity, leading to the formation of desired products with high efficiency and purity. By harnessing the reactivity of $name$, chemists can streamline synthetic routes and access novel compounds that may have utility in various fields of chemistry.Overall, the application of N-(1-{5-Methyl-1-[5-(trifluoromethyl)pyridin-2-yl]-1H-pyrazol-4-yl}ethylidene)hydroxylamine in chemical synthesis demonstrates its significance as a versatile building block for creating complex molecules with tailored properties and functions. Its role in synthesizing heterocyclic compounds highlights its potential to impact diverse areas of research and innovation within the realm of organic chemistry.